About [(E,2S)-hex-3-en-2-yl] cyanate
[(E,2S)-hex-3-en-2-yl] cyanate (PubChem CID 135038117) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is [(E,2S)-hex-3-en-2-yl] cyanate.
Molecular Properties
| Compound Name | [(E,2S)-hex-3-en-2-yl] cyanate |
| PubChem CID | 135038117 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | [(E,2S)-hex-3-en-2-yl] cyanate |
| SMILES | CC/C=C/[C@H](C)OC#N |
| InChI | InChI=1S/C7H11NO/c1-3-4-5-7(2)9-6-8/h4-5,7H,3H2,1-2H3/b5-4+/t7-/m0/s1 |
| InChIKey | VBGDZEJEBROENN-KPJROHGDSA-N |
| XLogP | 1.84 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E,2S)-hex-3-en-2-yl] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,2S)-hex-3-en-2-yl] cyanate?
The IUPAC name of [(E,2S)-hex-3-en-2-yl] cyanate (CID 135038117) is [(E,2S)-hex-3-en-2-yl] cyanate.
What is the SMILES notation for [(E,2S)-hex-3-en-2-yl] cyanate?
The canonical SMILES for [(E,2S)-hex-3-en-2-yl] cyanate is CC/C=C/[C@H](C)OC#N.
What is the InChIKey of [(E,2S)-hex-3-en-2-yl] cyanate?
The InChIKey is VBGDZEJEBROENN-KPJROHGDSA-N. The full InChI is InChI=1S/C7H11NO/c1-3-4-5-7(2)9-6-8/h4-5,7H,3H2,1-2H3/b5-4+/t7-/m0/s1.
What are the key properties of [(E,2S)-hex-3-en-2-yl] cyanate?
[(E,2S)-hex-3-en-2-yl] cyanate has a molecular weight of 125.17 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,2S)-hex-3-en-2-yl] cyanate is sourced from PubChem (CID 135038117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).