C12H16O4 — CID 135038199
methyl 2-acetyloxy-4,5-dimethylcyclohexa-1,4-diene-1-carboxylate (PubChem CID 135038199) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is methyl 2-acetyloxy-4,5-dimethylcyclohexa-1,4-diene-1-carboxylate.
| Compound Name | methyl 2-acetyloxy-4,5-dimethylcyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 135038199 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | methyl 2-acetyloxy-4,5-dimethylcyclohexa-1,4-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(OC(C)=O)CC(C)=C(C)C1 |
| InChI | InChI=1S/C12H16O4/c1-7-5-10(12(14)15-4)11(6-8(7)2)16-9(3)13/h5-6H2,1-4H3 |
| InChIKey | PKMWZOWHVBDKGE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|