About (4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile
(4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile (PubChem CID 135038235) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is (4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile.
Molecular Properties
| Compound Name | (4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile |
| PubChem CID | 135038235 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile |
| SMILES | C=C(C)C(O)CC/C(C)=C/CCC#N |
| InChI | InChI=1S/C12H19NO/c1-10(2)12(14)8-7-11(3)6-4-5-9-13/h6,12,14H,1,4-5,7-8H2,2-3H3/b11-6+ |
| InChIKey | BCPVDYDFJPETTL-IZZDOVSWSA-N |
| XLogP | 2.95 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile?
The IUPAC name of (4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile (CID 135038235) is (4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile.
What is the SMILES notation for (4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile?
The canonical SMILES for (4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile is C=C(C)C(O)CC/C(C)=C/CCC#N.
What is the InChIKey of (4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile?
The InChIKey is BCPVDYDFJPETTL-IZZDOVSWSA-N. The full InChI is InChI=1S/C12H19NO/c1-10(2)12(14)8-7-11(3)6-4-5-9-13/h6,12,14H,1,4-5,7-8H2,2-3H3/b11-6+.
What are the key properties of (4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile?
(4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile has a molecular weight of 193.29 g/mol, XLogP of 2.95, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-8-hydroxy-5,9-dimethyldeca-4,9-dienenitrile is sourced from PubChem (CID 135038235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).