About 3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one
3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one (PubChem CID 135038285) has the molecular formula C15H18INO
and a molecular weight of 355.22 g/mol. Its IUPAC name is 3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one.
Molecular Properties
| Compound Name | 3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one |
| PubChem CID | 135038285 |
| Molecular Formula | C15H18INO |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one |
| SMILES | CC(C)(C)C1=C(I)C(=O)C23CCCC2=CC=CN13 |
| InChI | InChI=1S/C15H18INO/c1-14(2,3)12-11(16)13(18)15-8-4-6-10(15)7-5-9-17(12)15/h5,7,9H,4,6,8H2,1-3H3 |
| InChIKey | DGRMGLITBDCFRK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one?
The IUPAC name of 3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one (CID 135038285) is 3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one.
What is the SMILES notation for 3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one?
The canonical SMILES for 3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one is CC(C)(C)C1=C(I)C(=O)C23CCCC2=CC=CN13.
What is the InChIKey of 3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one?
The InChIKey is DGRMGLITBDCFRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18INO/c1-14(2,3)12-11(16)13(18)15-8-4-6-10(15)7-5-9-17(12)15/h5,7,9H,4,6,8H2,1-3H3.
What are the key properties of 3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one?
3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one has a molecular weight of 355.22 g/mol, XLogP of 3.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2-iodo-9,10-dihydro-8H-cyclopenta[h]indolizin-1-one is sourced from PubChem (CID 135038285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).