C12H20N2O3 — CID 135038306
methyl (3S,9aR)-2-acetyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-3-carboxylate (PubChem CID 135038306) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is methyl (3S,9aR)-2-acetyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-3-carboxylate.
| Compound Name | methyl (3S,9aR)-2-acetyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-3-carboxylate |
|---|---|
| PubChem CID | 135038306 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | methyl (3S,9aR)-2-acetyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CN2CCCC[C@@H]2CN1C(C)=O |
| InChI | InChI=1S/C12H20N2O3/c1-9(15)14-7-10-5-3-4-6-13(10)8-11(14)12(16)17-2/h10-11H,3-8H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | XLJYQJGFAATOBM-MNOVXSKESA-N |
| XLogP | 0.24 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |