C13H15NO — CID 135038335
9a-methyl-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-one (PubChem CID 135038335) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 9a-methyl-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-one.
| Compound Name | 9a-methyl-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-one |
|---|---|
| PubChem CID | 135038335 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 9a-methyl-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-one |
| SMILES | CC12C=CC=CN1C1=C(CCCC1)C2=O |
| InChI | InChI=1S/C13H15NO/c1-13-8-4-5-9-14(13)11-7-3-2-6-10(11)12(13)15/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | VPXVTRDPNFHQJY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |