C13H22O5 — CID 135038417
(3'aR,4R)-2,2,2',2',7'-pentamethylspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran] (PubChem CID 135038417) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (3'aR,4R)-2,2,2',2',7'-pentamethylspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran].
| Compound Name | (3'aR,4R)-2,2,2',2',7'-pentamethylspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran] |
|---|---|
| PubChem CID | 135038417 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (3'aR,4R)-2,2,2',2',7'-pentamethylspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran] |
| SMILES | CC1C2OC(C)(C)O[C@@H]2CO[C@]12COC(C)(C)O2 |
| InChI | InChI=1S/C13H22O5/c1-8-10-9(16-12(4,5)17-10)6-14-13(8)7-15-11(2,3)18-13/h8-10H,6-7H2,1-5H3/t8?,9-,10?,13+/m1/s1 |
| InChIKey | LWRVZHRTSAPDRZ-SCZOVPDESA-N |
| XLogP | 1.65 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |