About 3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole
3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole (PubChem CID 135038496) has the molecular formula C15H21NO3S
and a molecular weight of 295.40 g/mol. Its IUPAC name is 3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole |
| PubChem CID | 135038496 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole |
| SMILES | COC1=CCN(S(=O)(=O)c2ccc(C)cc2)C1C(C)C |
| InChI | InChI=1S/C15H21NO3S/c1-11(2)15-14(19-4)9-10-16(15)20(17,18)13-7-5-12(3)6-8-13/h5-9,11,15H,10H2,1-4H3 |
| InChIKey | MYCJSGUFKILIFH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole?
The IUPAC name of 3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole (CID 135038496) is 3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole.
What is the SMILES notation for 3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole?
The canonical SMILES for 3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole is COC1=CCN(S(=O)(=O)c2ccc(C)cc2)C1C(C)C.
What is the InChIKey of 3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole?
The InChIKey is MYCJSGUFKILIFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3S/c1-11(2)15-14(19-4)9-10-16(15)20(17,18)13-7-5-12(3)6-8-13/h5-9,11,15H,10H2,1-4H3.
What are the key properties of 3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole?
3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole has a molecular weight of 295.40 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-1-(4-methylphenyl)sulfonyl-2-propan-2-yl-2,5-dihydropyrrole is sourced from PubChem (CID 135038496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).