C11H14O4 — CID 135038607
(1E,5E)-1-methoxy-2-methoxycarbonylocta-1,5,7-trien-1-olate (PubChem CID 135038607) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (1E,5E)-1-methoxy-2-methoxycarbonylocta-1,5,7-trien-1-olate.
| Compound Name | (1E,5E)-1-methoxy-2-methoxycarbonylocta-1,5,7-trien-1-olate |
|---|---|
| PubChem CID | 135038607 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (1E,5E)-1-methoxy-2-methoxycarbonylocta-1,5,7-trien-1-olate |
| SMILES | C=C/C=C/[CH+]C/C(C(=O)OC)=C(/[O-])OC |
| InChI | InChI=1S/C11H14O4/c1-4-5-6-7-8-9(10(12)14-2)11(13)15-3/h4-7H,1,8H2,2-3H3/b6-5+ |
| InChIKey | VYXZNIAHXNFDGY-AATRIKPKSA-N |
| XLogP | 0.71 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|