C15H20OS2 — CID 135038720
(7'aS)-7'a-prop-2-enylspiro[1,3-dithiane-2,5'-2,3,6,7-tetrahydroindene]-1'-one (PubChem CID 135038720) has the molecular formula C15H20OS2 and a molecular weight of 280.46 g/mol. Its IUPAC name is (7'aS)-7'a-prop-2-enylspiro[1,3-dithiane-2,5'-2,3,6,7-tetrahydroindene]-1'-one.
| Compound Name | (7'aS)-7'a-prop-2-enylspiro[1,3-dithiane-2,5'-2,3,6,7-tetrahydroindene]-1'-one |
|---|---|
| PubChem CID | 135038720 |
| Molecular Formula | C15H20OS2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (7'aS)-7'a-prop-2-enylspiro[1,3-dithiane-2,5'-2,3,6,7-tetrahydroindene]-1'-one |
| SMILES | C=CC[C@@]12CCC3(C=C1CCC2=O)SCCCS3 |
| InChI | InChI=1S/C15H20OS2/c1-2-6-14-7-8-15(17-9-3-10-18-15)11-12(14)4-5-13(14)16/h2,11H,1,3-10H2/t14-/m1/s1 |
| InChIKey | PTGGXOPQKCMLJF-CQSZACIVSA-N |
| XLogP | 4.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|