C14H22O — CID 135038751
(1R,2R,4S,6R)-7,7-dimethyl-2-pent-4-enyl-3-oxatricyclo[4.1.1.02,4]octane (PubChem CID 135038751) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (1R,2R,4S,6R)-7,7-dimethyl-2-pent-4-enyl-3-oxatricyclo[4.1.1.02,4]octane.
| Compound Name | (1R,2R,4S,6R)-7,7-dimethyl-2-pent-4-enyl-3-oxatricyclo[4.1.1.02,4]octane |
|---|---|
| PubChem CID | 135038751 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (1R,2R,4S,6R)-7,7-dimethyl-2-pent-4-enyl-3-oxatricyclo[4.1.1.02,4]octane |
| SMILES | C=CCCC[C@]12O[C@H]1C[C@H]1C[C@@H]2C1(C)C |
| InChI | InChI=1S/C14H22O/c1-4-5-6-7-14-11-8-10(13(11,2)3)9-12(14)15-14/h4,10-12H,1,5-9H2,2-3H3/t10-,11-,12+,14-/m1/s1 |
| InChIKey | OMHDLTUNRNXCRY-NRWUCQMLSA-N |
| XLogP | 3.55 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|