C11H20OS — CID 135038761
(8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiine (PubChem CID 135038761) has the molecular formula C11H20OS and a molecular weight of 200.35 g/mol. Its IUPAC name is (8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiine.
| Compound Name | (8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiine |
|---|---|
| PubChem CID | 135038761 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiine |
| SMILES | CC1CCC2[C@@H](C1)OCSC2(C)C |
| InChI | InChI=1S/C11H20OS/c1-8-4-5-9-10(6-8)12-7-13-11(9,2)3/h8-10H,4-7H2,1-3H3/t8?,9?,10-/m1/s1 |
| InChIKey | PNVITKURGNERLY-UDNWOFFPSA-N |
| XLogP | 3.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |