C16H18O4 — CID 135038864
3-[(2E,4E,6E)-4,6-dimethylocta-2,4,6-trienoyl]-4-methoxy-5-methylidenefuran-2-one (PubChem CID 135038864) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-[(2E,4E,6E)-4,6-dimethylocta-2,4,6-trienoyl]-4-methoxy-5-methylidenefuran-2-one.
| Compound Name | 3-[(2E,4E,6E)-4,6-dimethylocta-2,4,6-trienoyl]-4-methoxy-5-methylidenefuran-2-one |
|---|---|
| PubChem CID | 135038864 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-[(2E,4E,6E)-4,6-dimethylocta-2,4,6-trienoyl]-4-methoxy-5-methylidenefuran-2-one |
| SMILES | C=C1OC(=O)C(C(=O)/C=C/C(C)=C/C(C)=C/C)=C1OC |
| InChI | InChI=1S/C16H18O4/c1-6-10(2)9-11(3)7-8-13(17)14-15(19-5)12(4)20-16(14)18/h6-9H,4H2,1-3,5H3/b8-7+,10-6+,11-9+ |
| InChIKey | JNELTDAEJRYRNH-AIQQMXLGSA-N |
| XLogP | 3.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|