C9H10O7 — CID 135038886
(3R,3aR,6aR)-2,3,6-trihydroxyspiro[3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5,5'-furan]-2'-one (PubChem CID 135038886) has the molecular formula C9H10O7 and a molecular weight of 230.17 g/mol. Its IUPAC name is (3R,3aR,6aR)-2,3,6-trihydroxyspiro[3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5,5'-furan]-2'-one.
| Compound Name | (3R,3aR,6aR)-2,3,6-trihydroxyspiro[3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5,5'-furan]-2'-one |
|---|---|
| PubChem CID | 135038886 |
| Molecular Formula | C9H10O7 |
| Molecular Weight | 230.17 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | (3R,3aR,6aR)-2,3,6-trihydroxyspiro[3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5,5'-furan]-2'-one |
| SMILES | O=C1C=CC2(O1)O[C@H]1[C@H](OC(O)[C@@H]1O)C2O |
| InChI | InChI=1S/C9H10O7/c10-3-1-2-9(15-3)7(12)6-5(16-9)4(11)8(13)14-6/h1-2,4-8,11-13H/t4-,5-,6+,7?,8?,9?/m1/s1 |
| InChIKey | PEXMWIKMCUCPFF-BFJQIXGLSA-N |
| XLogP | -2.37 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.17 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |