C14H25NO2 — CID 135038890
tert-butyl N-[(2E,4E)-6,6-dimethylhepta-2,4-dienyl]carbamate (PubChem CID 135038890) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is tert-butyl N-[(2E,4E)-6,6-dimethylhepta-2,4-dienyl]carbamate.
| Compound Name | tert-butyl N-[(2E,4E)-6,6-dimethylhepta-2,4-dienyl]carbamate |
|---|---|
| PubChem CID | 135038890 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | tert-butyl N-[(2E,4E)-6,6-dimethylhepta-2,4-dienyl]carbamate |
| SMILES | CC(C)(C)/C=C/C=C/CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO2/c1-13(2,3)10-8-7-9-11-15-12(16)17-14(4,5)6/h7-10H,11H2,1-6H3,(H,15,16)/b9-7+,10-8+ |
| InChIKey | ATGWQUCRULXHAB-FIFLTTCUSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|