C8H14N+ — CID 135038907
(3aR,7aS)-2,3,3a,4,5,7a-hexahydro-1H-indol-1-ium (PubChem CID 135038907) has the molecular formula C8H14N+ and a molecular weight of 124.21 g/mol. Its IUPAC name is (3aR,7aS)-2,3,3a,4,5,7a-hexahydro-1H-indol-1-ium.
| Compound Name | (3aR,7aS)-2,3,3a,4,5,7a-hexahydro-1H-indol-1-ium |
|---|---|
| PubChem CID | 135038907 |
| Molecular Formula | C8H14N+ |
| Molecular Weight | 124.21 g/mol |
| Exact Mass | 124.11 |
| IUPAC Name | (3aR,7aS)-2,3,3a,4,5,7a-hexahydro-1H-indol-1-ium |
| SMILES | C1=C[C@H]2[NH2+]CC[C@H]2CC1 |
| InChI | InChI=1S/C8H13N/c1-2-4-8-7(3-1)5-6-9-8/h2,4,7-9H,1,3,5-6H2/p+1/t7-,8-/m1/s1 |
| InChIKey | MFOUWLGLIHXCOZ-HTQZYQBOSA-O |
| XLogP | 0.29 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.21 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|