About (2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran
(2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran (PubChem CID 135039074) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is (2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | (2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran |
| PubChem CID | 135039074 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran |
| SMILES | COC=CCCC[C@H]1C(OC)=CO[C@H]1C |
| InChI | InChI=1S/C12H20O3/c1-10-11(12(14-3)9-15-10)7-5-4-6-8-13-2/h6,8-11H,4-5,7H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | LCHIZWNNICPDCS-WDEREUQCSA-N |
| XLogP | 2.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran?
The IUPAC name of (2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran (CID 135039074) is (2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran.
What is the SMILES notation for (2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran?
The canonical SMILES for (2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran is COC=CCCC[C@H]1C(OC)=CO[C@H]1C.
What is the InChIKey of (2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran?
The InChIKey is LCHIZWNNICPDCS-WDEREUQCSA-N. The full InChI is InChI=1S/C12H20O3/c1-10-11(12(14-3)9-15-10)7-5-4-6-8-13-2/h6,8-11H,4-5,7H2,1-3H3/t10-,11+/m0/s1.
What are the key properties of (2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran?
(2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran has a molecular weight of 212.29 g/mol, XLogP of 2.84, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-4-methoxy-3-(5-methoxypent-4-enyl)-2-methyl-2,3-dihydrofuran is sourced from PubChem (CID 135039074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).