About (2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one
(2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one (PubChem CID 135039273) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is (2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one.
Molecular Properties
| Compound Name | (2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one |
| PubChem CID | 135039273 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one |
| SMILES | O=C([C@H](O)CO)N1CCOCC1 |
| InChI | InChI=1S/C7H13NO4/c9-5-6(10)7(11)8-1-3-12-4-2-8/h6,9-10H,1-5H2/t6-/m1/s1 |
| InChIKey | AYGOIIDKEHULEC-ZCFIWIBFSA-N |
| XLogP | -1.80 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one?
The IUPAC name of (2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one (CID 135039273) is (2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one.
What is the SMILES notation for (2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one?
The canonical SMILES for (2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one is O=C([C@H](O)CO)N1CCOCC1.
What is the InChIKey of (2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one?
The InChIKey is AYGOIIDKEHULEC-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H13NO4/c9-5-6(10)7(11)8-1-3-12-4-2-8/h6,9-10H,1-5H2/t6-/m1/s1.
What are the key properties of (2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one?
(2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one has a molecular weight of 175.18 g/mol, XLogP of -1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,3-dihydroxy-1-morpholin-4-ylpropan-1-one is sourced from PubChem (CID 135039273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).