C14H20O6 — CID 135039393
methyl (2R,3R,4aS,8aS)-2,3-dimethoxy-2,3-dimethyl-4a,8a-dihydro-1,4-benzodioxine-5-carboxylate (PubChem CID 135039393) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is methyl (2R,3R,4aS,8aS)-2,3-dimethoxy-2,3-dimethyl-4a,8a-dihydro-1,4-benzodioxine-5-carboxylate.
| Compound Name | methyl (2R,3R,4aS,8aS)-2,3-dimethoxy-2,3-dimethyl-4a,8a-dihydro-1,4-benzodioxine-5-carboxylate |
|---|---|
| PubChem CID | 135039393 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | methyl (2R,3R,4aS,8aS)-2,3-dimethoxy-2,3-dimethyl-4a,8a-dihydro-1,4-benzodioxine-5-carboxylate |
| SMILES | COC(=O)C1=CC=C[C@@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@@H]12 |
| InChI | InChI=1S/C14H20O6/c1-13(17-4)14(2,18-5)20-11-9(12(15)16-3)7-6-8-10(11)19-13/h6-8,10-11H,1-5H3/t10-,11-,13+,14+/m0/s1 |
| InChIKey | CECUYLTYTVFXLY-CDGCEXEKSA-N |
| XLogP | 1.16 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |