C17H27NO5 — CID 135039419
(2R,3S,4R)-2,3,4-trihydroxy-N,N-dimethyl-8-phenylmethoxyoctanamide (PubChem CID 135039419) has the molecular formula C17H27NO5 and a molecular weight of 325.40 g/mol. Its IUPAC name is (2R,3S,4R)-2,3,4-trihydroxy-N,N-dimethyl-8-phenylmethoxyoctanamide.
| Compound Name | (2R,3S,4R)-2,3,4-trihydroxy-N,N-dimethyl-8-phenylmethoxyoctanamide |
|---|---|
| PubChem CID | 135039419 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (2R,3S,4R)-2,3,4-trihydroxy-N,N-dimethyl-8-phenylmethoxyoctanamide |
| SMILES | CN(C)C(=O)[C@H](O)[C@@H](O)[C@H](O)CCCCOCc1ccccc1 |
| InChI | InChI=1S/C17H27NO5/c1-18(2)17(22)16(21)15(20)14(19)10-6-7-11-23-12-13-8-4-3-5-9-13/h3-5,8-9,14-16,19-21H,6-7,10-12H2,1-2H3/t14-,15+,16-/m1/s1 |
| InChIKey | QONRLHHPRKSSMT-OWCLPIDISA-N |
| XLogP | 0.54 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|