C13H24O3 — CID 135039529
3-(1,1-dimethoxyethoxy)-1,5,5-trimethylcyclohexene (PubChem CID 135039529) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 3-(1,1-dimethoxyethoxy)-1,5,5-trimethylcyclohexene.
| Compound Name | 3-(1,1-dimethoxyethoxy)-1,5,5-trimethylcyclohexene |
|---|---|
| PubChem CID | 135039529 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 3-(1,1-dimethoxyethoxy)-1,5,5-trimethylcyclohexene |
| SMILES | COC(C)(OC)OC1C=C(C)CC(C)(C)C1 |
| InChI | InChI=1S/C13H24O3/c1-10-7-11(9-12(2,3)8-10)16-13(4,14-5)15-6/h7,11H,8-9H2,1-6H3 |
| InChIKey | ZZFIDFWVZNOBNA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|