C14H23Cl — CID 135039547
trans-(3S,4R)-3-[(E)-5-chloropent-3-enyl]-4-ethenyl-1,1-dimethylcyclopentane (PubChem CID 135039547) has the molecular formula C14H23Cl and a molecular weight of 226.79 g/mol. Its IUPAC name is trans-(3S,4R)-3-[(E)-5-chloropent-3-enyl]-4-ethenyl-1,1-dimethylcyclopentane.
| Compound Name | trans-(3S,4R)-3-[(E)-5-chloropent-3-enyl]-4-ethenyl-1,1-dimethylcyclopentane |
|---|---|
| PubChem CID | 135039547 |
| Molecular Formula | C14H23Cl |
| Molecular Weight | 226.79 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | trans-(3S,4R)-3-[(E)-5-chloropent-3-enyl]-4-ethenyl-1,1-dimethylcyclopentane |
| SMILES | C=C[C@H]1CC(C)(C)C[C@@H]1CC/C=C/CCl |
| InChI | InChI=1S/C14H23Cl/c1-4-12-10-14(2,3)11-13(12)8-6-5-7-9-15/h4-5,7,12-13H,1,6,8-11H2,2-3H3/b7-5+/t12-,13-/m0/s1 |
| InChIKey | LGFRSFFVARXCGP-YTDWTQRBSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.79 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|