About trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane
trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane (PubChem CID 135039561) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane.
Molecular Properties
| Compound Name | trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane |
| PubChem CID | 135039561 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane |
| SMILES | C=CCC[C@H]1CC(C)(C)C[C@@H]1C=C |
| InChI | InChI=1S/C13H22/c1-5-7-8-12-10-13(3,4)9-11(12)6-2/h5-6,11-12H,1-2,7-10H2,3-4H3/t11-,12-/m0/s1 |
| InChIKey | ULLOKHHVMAKFDF-RYUDHWBXSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane?
The IUPAC name of trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane (CID 135039561) is trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane.
What is the SMILES notation for trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane?
The canonical SMILES for trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane is C=CCC[C@H]1CC(C)(C)C[C@@H]1C=C.
What is the InChIKey of trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane?
The InChIKey is ULLOKHHVMAKFDF-RYUDHWBXSA-N. The full InChI is InChI=1S/C13H22/c1-5-7-8-12-10-13(3,4)9-11(12)6-2/h5-6,11-12H,1-2,7-10H2,3-4H3/t11-,12-/m0/s1.
What are the key properties of trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane?
trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane has a molecular weight of 178.32 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3S,4R)-3-but-3-enyl-4-ethenyl-1,1-dimethylcyclopentane is sourced from PubChem (CID 135039561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).