About (E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene
(E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene (PubChem CID 135039643) has the molecular formula C16H32O3
and a molecular weight of 272.43 g/mol. Its IUPAC name is (E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene.
Molecular Properties
| Compound Name | (E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene |
| PubChem CID | 135039643 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | (E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene |
| SMILES | CC/C=C(\C)C(CCCCCC)OC(C)(OC)OC |
| InChI | InChI=1S/C16H32O3/c1-7-9-10-11-13-15(14(3)12-8-2)19-16(4,17-5)18-6/h12,15H,7-11,13H2,1-6H3/b14-12+ |
| InChIKey | YBFXDSVLYBTGOY-WYMLVPIESA-N |
| XLogP | 4.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene?
The IUPAC name of (E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene (CID 135039643) is (E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene.
What is the SMILES notation for (E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene?
The canonical SMILES for (E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene is CC/C=C(\C)C(CCCCCC)OC(C)(OC)OC.
What is the InChIKey of (E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene?
The InChIKey is YBFXDSVLYBTGOY-WYMLVPIESA-N. The full InChI is InChI=1S/C16H32O3/c1-7-9-10-11-13-15(14(3)12-8-2)19-16(4,17-5)18-6/h12,15H,7-11,13H2,1-6H3/b14-12+.
What are the key properties of (E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene?
(E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene has a molecular weight of 272.43 g/mol, XLogP of 4.66, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-(1,1-dimethoxyethoxy)-4-methylundec-3-ene is sourced from PubChem (CID 135039643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).