About 4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium
4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium (PubChem CID 135039660) has the molecular formula C8H9OY-
and a molecular weight of 210.06 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium.
Molecular Properties
| Compound Name | 4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium |
| PubChem CID | 135039660 |
| Molecular Formula | C8H9OY- |
| Molecular Weight | 210.06 g/mol |
| Exact Mass | 209.97 |
| IUPAC Name | 4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium |
| SMILES | [Y].[c-]1cc2c(o1)CCCC2 |
| InChI | InChI=1S/C8H9O.Y/c1-2-4-8-7(3-1)5-6-9-8;/h5H,1-4H2;/q-1; |
| InChIKey | OEVRTDWMLJXQNM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.06 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium?
The IUPAC name of 4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium (CID 135039660) is 4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium.
What is the SMILES notation for 4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium?
The canonical SMILES for 4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium is [Y].[c-]1cc2c(o1)CCCC2.
What is the InChIKey of 4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium?
The InChIKey is OEVRTDWMLJXQNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9O.Y/c1-2-4-8-7(3-1)5-6-9-8;/h5H,1-4H2;/q-1;.
What are the key properties of 4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium?
4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium has a molecular weight of 210.06 g/mol, XLogP of 1.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydro-2H-1-benzofuran-2-ide;yttrium is sourced from PubChem (CID 135039660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).