C9H6BrF6N — CID 135039667
2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-amine (PubChem CID 135039667) has the molecular formula C9H6BrF6N and a molecular weight of 322.05 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-amine.
| Compound Name | 2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-amine |
|---|---|
| PubChem CID | 135039667 |
| Molecular Formula | C9H6BrF6N |
| Molecular Weight | 322.05 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-amine |
| SMILES | NC(c1ccc(Br)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H6BrF6N/c10-6-3-1-5(2-4-6)7(17,8(11,12)13)9(14,15)16/h1-4H,17H2 |
| InChIKey | YXWSAPNFXSKQAF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.05 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |