About [(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol
[(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol (PubChem CID 135039811) has the molecular formula C14H15IO
and a molecular weight of 326.18 g/mol. Its IUPAC name is [(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol |
| PubChem CID | 135039811 |
| Molecular Formula | C14H15IO |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | [(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol |
| SMILES | CC1=CCC(I)=C(c2ccccc2)[C@H]1CO |
| InChI | InChI=1S/C14H15IO/c1-10-7-8-13(15)14(12(10)9-16)11-5-3-2-4-6-11/h2-7,12,16H,8-9H2,1H3/t12-/m0/s1 |
| InChIKey | ALXWPZAJZNNSTG-LBPRGKRZSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol?
The IUPAC name of [(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol (CID 135039811) is [(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol.
What is the SMILES notation for [(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol?
The canonical SMILES for [(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol is CC1=CCC(I)=C(c2ccccc2)[C@H]1CO.
What is the InChIKey of [(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol?
The InChIKey is ALXWPZAJZNNSTG-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H15IO/c1-10-7-8-13(15)14(12(10)9-16)11-5-3-2-4-6-11/h2-7,12,16H,8-9H2,1H3/t12-/m0/s1.
What are the key properties of [(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol?
[(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol has a molecular weight of 326.18 g/mol, XLogP of 3.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-3-iodo-6-methyl-2-phenylcyclohexa-2,5-dien-1-yl]methanol is sourced from PubChem (CID 135039811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).