C13H22O5 — CID 135039827
methyl 5-[2-[(3R)-3-hydroxybutyl]-1,3-dioxolan-2-yl]pent-3-enoate (PubChem CID 135039827) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is methyl 5-[2-[(3R)-3-hydroxybutyl]-1,3-dioxolan-2-yl]pent-3-enoate.
| Compound Name | methyl 5-[2-[(3R)-3-hydroxybutyl]-1,3-dioxolan-2-yl]pent-3-enoate |
|---|---|
| PubChem CID | 135039827 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | methyl 5-[2-[(3R)-3-hydroxybutyl]-1,3-dioxolan-2-yl]pent-3-enoate |
| SMILES | COC(=O)CC=CCC1(CC[C@@H](C)O)OCCO1 |
| InChI | InChI=1S/C13H22O5/c1-11(14)6-8-13(17-9-10-18-13)7-4-3-5-12(15)16-2/h3-4,11,14H,5-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | PZIHMCZGFPANGK-LLVKDONJSA-N |
| XLogP | 1.40 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|