C9H14O4S — CID 135039847
(4S,7R)-4-methyl-1,1-dioxo-3,4,5,6,7,8-hexahydro-2,1λ6-benzoxathiin-7-ol (PubChem CID 135039847) has the molecular formula C9H14O4S and a molecular weight of 218.27 g/mol. Its IUPAC name is (4S,7R)-4-methyl-1,1-dioxo-3,4,5,6,7,8-hexahydro-2,1λ6-benzoxathiin-7-ol.
| Compound Name | (4S,7R)-4-methyl-1,1-dioxo-3,4,5,6,7,8-hexahydro-2,1λ6-benzoxathiin-7-ol |
|---|---|
| PubChem CID | 135039847 |
| Molecular Formula | C9H14O4S |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | (4S,7R)-4-methyl-1,1-dioxo-3,4,5,6,7,8-hexahydro-2,1λ6-benzoxathiin-7-ol |
| SMILES | C[C@@H]1COS(=O)(=O)C2=C1CC[C@@H](O)C2 |
| InChI | InChI=1S/C9H14O4S/c1-6-5-13-14(11,12)9-4-7(10)2-3-8(6)9/h6-7,10H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | MHHXOLDAKPJCCP-RNFRBKRXSA-N |
| XLogP | 0.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|