About (Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate
(Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate (PubChem CID 135039903) has the molecular formula C9H9O-
and a molecular weight of 133.17 g/mol. Its IUPAC name is (Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate.
Molecular Properties
| Compound Name | (Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate |
| PubChem CID | 135039903 |
| Molecular Formula | C9H9O- |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | (Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate |
| SMILES | C/C([O-])=C/C=C1C=CC=C1 |
| InChI | InChI=1S/C9H10O/c1-8(10)6-7-9-4-2-3-5-9/h2-7,10H,1H3/p-1/b8-6- |
| InChIKey | DEFXFBBJSPEQJY-VURMDHGXSA-M |
| XLogP | 1.30 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate?
The IUPAC name of (Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate (CID 135039903) is (Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate.
What is the SMILES notation for (Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate?
The canonical SMILES for (Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate is C/C([O-])=C/C=C1C=CC=C1.
What is the InChIKey of (Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate?
The InChIKey is DEFXFBBJSPEQJY-VURMDHGXSA-M. The full InChI is InChI=1S/C9H10O/c1-8(10)6-7-9-4-2-3-5-9/h2-7,10H,1H3/p-1/b8-6-.
What are the key properties of (Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate?
(Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate has a molecular weight of 133.17 g/mol, XLogP of 1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-cyclopenta-2,4-dien-1-ylidenebut-2-en-2-olate is sourced from PubChem (CID 135039903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).