About ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate
ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate (PubChem CID 135039922) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate.
Molecular Properties
| Compound Name | ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate |
| PubChem CID | 135039922 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate |
| SMILES | CCOC(=O)C[C@@H](O)C[C@H](O)C=C(C)C |
| InChI | InChI=1S/C11H20O4/c1-4-15-11(14)7-10(13)6-9(12)5-8(2)3/h5,9-10,12-13H,4,6-7H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | QOCDEJZSLOMLPJ-ZJUUUORDSA-N |
| XLogP | 1.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate?
The IUPAC name of ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate (CID 135039922) is ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate.
What is the SMILES notation for ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate?
The canonical SMILES for ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate is CCOC(=O)C[C@@H](O)C[C@H](O)C=C(C)C.
What is the InChIKey of ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate?
The InChIKey is QOCDEJZSLOMLPJ-ZJUUUORDSA-N. The full InChI is InChI=1S/C11H20O4/c1-4-15-11(14)7-10(13)6-9(12)5-8(2)3/h5,9-10,12-13H,4,6-7H2,1-3H3/t9-,10+/m1/s1.
What are the key properties of ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate?
ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate has a molecular weight of 216.28 g/mol, XLogP of 1.02, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3S,5S)-3,5-dihydroxy-7-methyloct-6-enoate is sourced from PubChem (CID 135039922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).