C15H20O2Si — CID 135039951
2-[(Z)-4-trimethylsilylbut-1-en-3-ynyl]-3,5,6,7-tetrahydro-2H-cyclopenta[b]pyran-4-one (PubChem CID 135039951) has the molecular formula C15H20O2Si and a molecular weight of 260.41 g/mol. Its IUPAC name is 2-[(Z)-4-trimethylsilylbut-1-en-3-ynyl]-3,5,6,7-tetrahydro-2H-cyclopenta[b]pyran-4-one.
| Compound Name | 2-[(Z)-4-trimethylsilylbut-1-en-3-ynyl]-3,5,6,7-tetrahydro-2H-cyclopenta[b]pyran-4-one |
|---|---|
| PubChem CID | 135039951 |
| Molecular Formula | C15H20O2Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-[(Z)-4-trimethylsilylbut-1-en-3-ynyl]-3,5,6,7-tetrahydro-2H-cyclopenta[b]pyran-4-one |
| SMILES | C[Si](C)(C)C#C/C=C\C1CC(=O)C2=C(CCC2)O1 |
| InChI | InChI=1S/C15H20O2Si/c1-18(2,3)10-5-4-7-12-11-14(16)13-8-6-9-15(13)17-12/h4,7,12H,6,8-9,11H2,1-3H3/b7-4- |
| InChIKey | RQFMGIYFSZNWFX-DAXSKMNVSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|