C13H28O4Si — CID 135040151
(2S,3S,4R)-1-[tert-butyl(dimethyl)silyl]oxyhept-6-ene-2,3,4-triol (PubChem CID 135040151) has the molecular formula C13H28O4Si and a molecular weight of 276.45 g/mol. Its IUPAC name is (2S,3S,4R)-1-[tert-butyl(dimethyl)silyl]oxyhept-6-ene-2,3,4-triol.
| Compound Name | (2S,3S,4R)-1-[tert-butyl(dimethyl)silyl]oxyhept-6-ene-2,3,4-triol |
|---|---|
| PubChem CID | 135040151 |
| Molecular Formula | C13H28O4Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (2S,3S,4R)-1-[tert-butyl(dimethyl)silyl]oxyhept-6-ene-2,3,4-triol |
| SMILES | C=CC[C@@H](O)[C@H](O)[C@@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28O4Si/c1-7-8-10(14)12(16)11(15)9-17-18(5,6)13(2,3)4/h7,10-12,14-16H,1,8-9H2,2-6H3/t10-,11+,12+/m1/s1 |
| InChIKey | PHPUEDHIJXEACS-WOPDTQHZSA-N |
| XLogP | 1.67 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|