C12H21ClO4 — CID 135040163
(4R)-4-(chloromethyl)-5-[(1S)-1-(methoxymethoxy)but-3-enyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 135040163) has the molecular formula C12H21ClO4 and a molecular weight of 264.75 g/mol. Its IUPAC name is (4R)-4-(chloromethyl)-5-[(1S)-1-(methoxymethoxy)but-3-enyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-(chloromethyl)-5-[(1S)-1-(methoxymethoxy)but-3-enyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 135040163 |
| Molecular Formula | C12H21ClO4 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (4R)-4-(chloromethyl)-5-[(1S)-1-(methoxymethoxy)but-3-enyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=CC[C@H](OCOC)C1OC(C)(C)O[C@H]1CCl |
| InChI | InChI=1S/C12H21ClO4/c1-5-6-9(15-8-14-4)11-10(7-13)16-12(2,3)17-11/h5,9-11H,1,6-8H2,2-4H3/t9-,10-,11?/m0/s1 |
| InChIKey | LXXWZXMNVYFUOH-QRHSGQBVSA-N |
| XLogP | 2.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|