C12H18O3 — CID 135040370
(3R,8R)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadec-13-ene (PubChem CID 135040370) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (3R,8R)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadec-13-ene.
| Compound Name | (3R,8R)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadec-13-ene |
|---|---|
| PubChem CID | 135040370 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (3R,8R)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadec-13-ene |
| SMILES | C1=CCC2O[C@@H]3CCCO[C@@H]3CC2OC1 |
| InChI | InChI=1S/C12H18O3/c1-2-6-13-11-8-12-10(5-3-7-14-12)15-9(11)4-1/h1-2,9-12H,3-8H2/t9?,10-,11?,12-/m1/s1 |
| InChIKey | SCTNMTLOLOFYMT-RUJICJSRSA-N |
| XLogP | 1.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|