C14H21NO2 — CID 135040518
(4aS,8aR)-2-(3-hydroxy-3-methylbutyl)-4a,5,8,8a-tetrahydroisoquinolin-1-one (PubChem CID 135040518) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (4aS,8aR)-2-(3-hydroxy-3-methylbutyl)-4a,5,8,8a-tetrahydroisoquinolin-1-one.
| Compound Name | (4aS,8aR)-2-(3-hydroxy-3-methylbutyl)-4a,5,8,8a-tetrahydroisoquinolin-1-one |
|---|---|
| PubChem CID | 135040518 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (4aS,8aR)-2-(3-hydroxy-3-methylbutyl)-4a,5,8,8a-tetrahydroisoquinolin-1-one |
| SMILES | CC(C)(O)CCN1C=C[C@@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C14H21NO2/c1-14(2,17)8-10-15-9-7-11-5-3-4-6-12(11)13(15)16/h3-4,7,9,11-12,17H,5-6,8,10H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | PVNLPVSVINFREI-NWDGAFQWSA-N |
| XLogP | 2.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|