C14H17N3O2 — CID 135040543
2-(4-methoxyphenyl)-5-piperidin-1-yl-1,3,4-oxadiazole (PubChem CID 135040543) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-piperidin-1-yl-1,3,4-oxadiazole.
| Compound Name | 2-(4-methoxyphenyl)-5-piperidin-1-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 135040543 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-piperidin-1-yl-1,3,4-oxadiazole |
| SMILES | COc1ccc(-c2nnc(N3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C14H17N3O2/c1-18-12-7-5-11(6-8-12)13-15-16-14(19-13)17-9-3-2-4-10-17/h5-8H,2-4,9-10H2,1H3 |
| InChIKey | VHMNCKRMBQXZPR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |