About 2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline
2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 135040546) has the molecular formula C15H14BrN
and a molecular weight of 288.19 g/mol. Its IUPAC name is 2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 135040546 |
| Molecular Formula | C15H14BrN |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | Brc1ccccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H14BrN/c16-14-7-3-4-8-15(14)17-10-9-12-5-1-2-6-13(12)11-17/h1-8H,9-11H2 |
| InChIKey | AXJAXJLXJOOBID-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline (CID 135040546) is 2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline is Brc1ccccc1N1CCc2ccccc2C1.
What is the InChIKey of 2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline?
The InChIKey is AXJAXJLXJOOBID-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrN/c16-14-7-3-4-8-15(14)17-10-9-12-5-1-2-6-13(12)11-17/h1-8H,9-11H2.
What are the key properties of 2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline?
2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline has a molecular weight of 288.19 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromophenyl)-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 135040546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).