C14H19NO3 — CID 135040554
ethyl 3-[(4aS,8aR)-1-oxo-4a,5,8,8a-tetrahydroisoquinolin-2-yl]propanoate (PubChem CID 135040554) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is ethyl 3-[(4aS,8aR)-1-oxo-4a,5,8,8a-tetrahydroisoquinolin-2-yl]propanoate.
| Compound Name | ethyl 3-[(4aS,8aR)-1-oxo-4a,5,8,8a-tetrahydroisoquinolin-2-yl]propanoate |
|---|---|
| PubChem CID | 135040554 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | ethyl 3-[(4aS,8aR)-1-oxo-4a,5,8,8a-tetrahydroisoquinolin-2-yl]propanoate |
| SMILES | CCOC(=O)CCN1C=C[C@@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C14H19NO3/c1-2-18-13(16)8-10-15-9-7-11-5-3-4-6-12(11)14(15)17/h3-4,7,9,11-12H,2,5-6,8,10H2,1H3/t11-,12+/m0/s1 |
| InChIKey | MHZMONUURUJZMO-NWDGAFQWSA-N |
| XLogP | 1.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|