C10H24O4Si — CID 135040584
(2S,3S)-4-[tert-butyl(dimethyl)silyl]oxybutane-1,2,3-triol (PubChem CID 135040584) has the molecular formula C10H24O4Si and a molecular weight of 236.38 g/mol. Its IUPAC name is (2S,3S)-4-[tert-butyl(dimethyl)silyl]oxybutane-1,2,3-triol.
| Compound Name | (2S,3S)-4-[tert-butyl(dimethyl)silyl]oxybutane-1,2,3-triol |
|---|---|
| PubChem CID | 135040584 |
| Molecular Formula | C10H24O4Si |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (2S,3S)-4-[tert-butyl(dimethyl)silyl]oxybutane-1,2,3-triol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C10H24O4Si/c1-10(2,3)15(4,5)14-7-9(13)8(12)6-11/h8-9,11-13H,6-7H2,1-5H3/t8-,9-/m0/s1 |
| InChIKey | DHAYGFAZXIDQBN-IUCAKERBSA-N |
| XLogP | 0.72 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|