C16H28Si — CID 135040642
[(3E,6R)-6,10-dimethylundeca-3,9-dien-1-ynyl]-trimethylsilane (PubChem CID 135040642) has the molecular formula C16H28Si and a molecular weight of 248.49 g/mol. Its IUPAC name is [(3E,6R)-6,10-dimethylundeca-3,9-dien-1-ynyl]-trimethylsilane.
| Compound Name | [(3E,6R)-6,10-dimethylundeca-3,9-dien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 135040642 |
| Molecular Formula | C16H28Si |
| Molecular Weight | 248.49 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | [(3E,6R)-6,10-dimethylundeca-3,9-dien-1-ynyl]-trimethylsilane |
| SMILES | CC(C)=CCC[C@@H](C)C/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C16H28Si/c1-15(2)11-10-13-16(3)12-8-7-9-14-17(4,5)6/h7-8,11,16H,10,12-13H2,1-6H3/b8-7+/t16-/m0/s1 |
| InChIKey | YAWZEVMPEHNEKJ-WAVCKPEOSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|