C11H14O6 — CID 135040648
(3aR,5R,6R,6aR)-5-(hydroxymethyl)-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-furan]-2'-one (PubChem CID 135040648) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is (3aR,5R,6R,6aR)-5-(hydroxymethyl)-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-furan]-2'-one.
| Compound Name | (3aR,5R,6R,6aR)-5-(hydroxymethyl)-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-furan]-2'-one |
|---|---|
| PubChem CID | 135040648 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (3aR,5R,6R,6aR)-5-(hydroxymethyl)-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-furan]-2'-one |
| SMILES | CC1(C)O[C@H]2O[C@H](CO)[C@]3(C=CC(=O)O3)[C@H]2O1 |
| InChI | InChI=1S/C11H14O6/c1-10(2)16-8-9(17-10)14-6(5-12)11(8)4-3-7(13)15-11/h3-4,6,8-9,12H,5H2,1-2H3/t6-,8+,9-,11-/m1/s1 |
| InChIKey | SOAZHKGBIIJCLX-DYUFWOLASA-N |
| XLogP | -0.29 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |