About 2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium
2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium (PubChem CID 135040832) has the molecular formula C11H15O2Y-
and a molecular weight of 268.14 g/mol. Its IUPAC name is 2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium.
Molecular Properties
| Compound Name | 2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium |
| PubChem CID | 135040832 |
| Molecular Formula | C11H15O2Y- |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium |
| SMILES | CC(C)(C)C(O)c1cc[c-]cc1O.[Y] |
| InChI | InChI=1S/C11H15O2.Y/c1-11(2,3)10(13)8-6-4-5-7-9(8)12;/h4,6-7,10,12-13H,1-3H3;/q-1; |
| InChIKey | NNLIOJNSBGZPFT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium?
The IUPAC name of 2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium (CID 135040832) is 2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium.
What is the SMILES notation for 2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium?
The canonical SMILES for 2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium is CC(C)(C)C(O)c1cc[c-]cc1O.[Y].
What is the InChIKey of 2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium?
The InChIKey is NNLIOJNSBGZPFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15O2.Y/c1-11(2,3)10(13)8-6-4-5-7-9(8)12;/h4,6-7,10,12-13H,1-3H3;/q-1;.
What are the key properties of 2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium?
2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium has a molecular weight of 268.14 g/mol, XLogP of 2.27, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-2,2-dimethylpropyl)benzene-5-id-1-ol;yttrium is sourced from PubChem (CID 135040832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).