C10H12F4O3S — CID 135040835
ethyl 3-ethylsulfanylcarbonyl-4,5,5,5-tetrafluoropent-3-enoate (PubChem CID 135040835) has the molecular formula C10H12F4O3S and a molecular weight of 288.26 g/mol. Its IUPAC name is ethyl 3-ethylsulfanylcarbonyl-4,5,5,5-tetrafluoropent-3-enoate.
| Compound Name | ethyl 3-ethylsulfanylcarbonyl-4,5,5,5-tetrafluoropent-3-enoate |
|---|---|
| PubChem CID | 135040835 |
| Molecular Formula | C10H12F4O3S |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | ethyl 3-ethylsulfanylcarbonyl-4,5,5,5-tetrafluoropent-3-enoate |
| SMILES | CCOC(=O)CC(C(=O)SCC)=C(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F4O3S/c1-3-17-7(15)5-6(9(16)18-4-2)8(11)10(12,13)14/h3-5H2,1-2H3 |
| InChIKey | VDRKTPBJHNRXKE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|