About (3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal
(3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal (PubChem CID 135040925) has the molecular formula C12H26O3Si
and a molecular weight of 246.42 g/mol. Its IUPAC name is (3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal.
Molecular Properties
| Compound Name | (3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal |
| PubChem CID | 135040925 |
| Molecular Formula | C12H26O3Si |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal |
| SMILES | CC(C)(C=O)[C@@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H26O3Si/c1-11(2,3)16(6,7)15-8-10(14)12(4,5)9-13/h9-10,14H,8H2,1-7H3/t10-/m0/s1 |
| InChIKey | VIIVLVPTMKVDBN-JTQLQIEISA-N |
| XLogP | 2.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal?
The IUPAC name of (3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal (CID 135040925) is (3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal.
What is the SMILES notation for (3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal?
The canonical SMILES for (3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal is CC(C)(C=O)[C@@H](O)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of (3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal?
The InChIKey is VIIVLVPTMKVDBN-JTQLQIEISA-N. The full InChI is InChI=1S/C12H26O3Si/c1-11(2,3)16(6,7)15-8-10(14)12(4,5)9-13/h9-10,14H,8H2,1-7H3/t10-/m0/s1.
What are the key properties of (3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal?
(3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal has a molecular weight of 246.42 g/mol, XLogP of 2.59, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,2-dimethylbutanal is sourced from PubChem (CID 135040925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).