About tricyclo[5.4.1.01,5]dodecane
tricyclo[5.4.1.01,5]dodecane (PubChem CID 135040983) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is tricyclo[5.4.1.01,5]dodecane.
Molecular Properties
| Compound Name | tricyclo[5.4.1.01,5]dodecane |
| PubChem CID | 135040983 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | tricyclo[5.4.1.01,5]dodecane |
| SMILES | C1CCC23CCCC2CC(C1)C3 |
| InChI | InChI=1S/C12H20/c1-2-6-12-7-3-5-11(12)8-10(4-1)9-12/h10-11H,1-9H2 |
| InChIKey | WWJCZXBGXVFOEV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tricyclo[5.4.1.01,5]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.4.1.01,5]dodecane?
The IUPAC name of tricyclo[5.4.1.01,5]dodecane (CID 135040983) is tricyclo[5.4.1.01,5]dodecane.
What is the SMILES notation for tricyclo[5.4.1.01,5]dodecane?
The canonical SMILES for tricyclo[5.4.1.01,5]dodecane is C1CCC23CCCC2CC(C1)C3.
What is the InChIKey of tricyclo[5.4.1.01,5]dodecane?
The InChIKey is WWJCZXBGXVFOEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20/c1-2-6-12-7-3-5-11(12)8-10(4-1)9-12/h10-11H,1-9H2.
What are the key properties of tricyclo[5.4.1.01,5]dodecane?
tricyclo[5.4.1.01,5]dodecane has a molecular weight of 164.29 g/mol, XLogP of 3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.4.1.01,5]dodecane is sourced from PubChem (CID 135040983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).