methyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate

C15H20N2O2 — CID 135041040

IUPACmethyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate
SMILESCCCCN1C=NC(C(=O)OC)C1c1ccccc1
InChIInChI=1S/C15H20N2O2/c1-3-4-10-17-11-16-13(15(18)19-2)14(17)12-8-6-5-7-9-12/h5-9,11,13-14H,3-4,10H2,1-2H3
InChIKeyGQHFPYSFQXRUSJ-UHFFFAOYSA-N
MW260.34 g/mol
LogP2.41
Rot. Bonds5

About methyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate

methyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate (PubChem CID 135041040) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is methyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate.

Molecular Properties

Compound Namemethyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate
PubChem CID135041040
Molecular FormulaC15H20N2O2
Molecular Weight260.34 g/mol
Exact Mass260.15
IUPAC Namemethyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate
SMILESCCCCN1C=NC(C(=O)OC)C1c1ccccc1
InChIInChI=1S/C15H20N2O2/c1-3-4-10-17-11-16-13(15(18)19-2)14(17)12-8-6-5-7-9-12/h5-9,11,13-14H,3-4,10H2,1-2H3
InChIKeyGQHFPYSFQXRUSJ-UHFFFAOYSA-N
XLogP2.41
TPSA41.90 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.34
LogP ≤ 52.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate?
The IUPAC name of methyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate (CID 135041040) is methyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate.
What is the SMILES notation for methyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate?
The canonical SMILES for methyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate is CCCCN1C=NC(C(=O)OC)C1c1ccccc1.
What is the InChIKey of methyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate?
The InChIKey is GQHFPYSFQXRUSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c1-3-4-10-17-11-16-13(15(18)19-2)14(17)12-8-6-5-7-9-12/h5-9,11,13-14H,3-4,10H2,1-2H3.
What are the key properties of methyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate?
methyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate has a molecular weight of 260.34 g/mol, XLogP of 2.41, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-butyl-5-phenyl-4,5-dihydroimidazole-4-carboxylate is sourced from PubChem (CID 135041040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).