C12H18O2 — CID 135041073
(3aS,7aR)-7-cyclopropyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole (PubChem CID 135041073) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (3aS,7aR)-7-cyclopropyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole.
| Compound Name | (3aS,7aR)-7-cyclopropyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 135041073 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (3aS,7aR)-7-cyclopropyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole |
| SMILES | CC1(C)O[C@H]2CCC=C(C3CC3)[C@H]2O1 |
| InChI | InChI=1S/C12H18O2/c1-12(2)13-10-5-3-4-9(8-6-7-8)11(10)14-12/h4,8,10-11H,3,5-7H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | UMLBEXBREBHOBH-WDEREUQCSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|