About (1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one
(1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one (PubChem CID 135041078) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is (1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one.
Molecular Properties
| Compound Name | (1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one |
| PubChem CID | 135041078 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one |
| SMILES | CC1(C)C[C@@H]2C(CCO)C(=O)O[C@@H]21 |
| InChI | InChI=1S/C10H16O3/c1-10(2)5-7-6(3-4-11)9(12)13-8(7)10/h6-8,11H,3-5H2,1-2H3/t6?,7-,8+/m1/s1 |
| InChIKey | OBICPKIBNHWVGI-VVXQKDJTSA-N |
| XLogP | 0.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one?
The IUPAC name of (1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one (CID 135041078) is (1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one.
What is the SMILES notation for (1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one?
The canonical SMILES for (1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one is CC1(C)C[C@@H]2C(CCO)C(=O)O[C@@H]21.
What is the InChIKey of (1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one?
The InChIKey is OBICPKIBNHWVGI-VVXQKDJTSA-N. The full InChI is InChI=1S/C10H16O3/c1-10(2)5-7-6(3-4-11)9(12)13-8(7)10/h6-8,11H,3-5H2,1-2H3/t6?,7-,8+/m1/s1.
What are the key properties of (1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one?
(1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one has a molecular weight of 184.23 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-4-(2-hydroxyethyl)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-one is sourced from PubChem (CID 135041078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).