About 2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine
2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine (PubChem CID 135041086) has the molecular formula C16H14N4
and a molecular weight of 262.32 g/mol. Its IUPAC name is 2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine.
Molecular Properties
| Compound Name | 2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine |
| PubChem CID | 135041086 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine |
| SMILES | C(#Cc1cnccn1)CCCCC#Cc1cnccn1 |
| InChI | InChI=1S/C16H14N4/c1(3-5-7-15-13-17-9-11-19-15)2-4-6-8-16-14-18-10-12-20-16/h9-14H,1-4H2 |
| InChIKey | QAZNUCBUJVATGY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine?
The IUPAC name of 2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine (CID 135041086) is 2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine.
What is the SMILES notation for 2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine?
The canonical SMILES for 2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine is C(#Cc1cnccn1)CCCCC#Cc1cnccn1.
What is the InChIKey of 2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine?
The InChIKey is QAZNUCBUJVATGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4/c1(3-5-7-15-13-17-9-11-19-15)2-4-6-8-16-14-18-10-12-20-16/h9-14H,1-4H2.
What are the key properties of 2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine?
2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine has a molecular weight of 262.32 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-pyrazin-2-ylocta-1,7-diynyl)pyrazine is sourced from PubChem (CID 135041086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).